C24H21N5 — CID 133430717
2-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoline-6-carbonitrile (PubChem CID 133430717) has the molecular formula C24H21N5 and a molecular weight of 379.47 g/mol. Its IUPAC name is 2-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoline-6-carbonitrile.
| Compound Name | 2-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 133430717 |
| Molecular Formula | C24H21N5 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoline-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(N3CCCC(c4ncc(-c5ccccc5)[nH]4)C3)ccc2c1 |
| InChI | InChI=1S/C24H21N5/c25-14-17-8-10-21-19(13-17)9-11-23(27-21)29-12-4-7-20(16-29)24-26-15-22(28-24)18-5-2-1-3-6-18/h1-3,5-6,8-11,13,15,20H,4,7,12,16H2,(H,26,28) |
| InChIKey | YNHBXWWXTOFKFT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |