C26H28N6O — CID 133430774
4-[3-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoxalin-2-yl]morpholine (PubChem CID 133430774) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-[3-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoxalin-2-yl]morpholine.
| Compound Name | 4-[3-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoxalin-2-yl]morpholine |
|---|---|
| PubChem CID | 133430774 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 4-[3-[3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]quinoxalin-2-yl]morpholine |
| SMILES | c1ccc(-c2cnc(C3CCCN(c4nc5ccccc5nc4N4CCOCC4)C3)[nH]2)cc1 |
| InChI | InChI=1S/C26H28N6O/c1-2-7-19(8-3-1)23-17-27-24(28-23)20-9-6-12-32(18-20)26-25(31-13-15-33-16-14-31)29-21-10-4-5-11-22(21)30-26/h1-5,7-8,10-11,17,20H,6,9,12-16,18H2,(H,27,28) |
| InChIKey | GCMYZCGGETZMNH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |