C19H18ClFN4O2 — CID 133431271
4-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-3-nitrobenzonitrile (PubChem CID 133431271) has the molecular formula C19H18ClFN4O2 and a molecular weight of 388.83 g/mol. Its IUPAC name is 4-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-3-nitrobenzonitrile.
| Compound Name | 4-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 133431271 |
| Molecular Formula | C19H18ClFN4O2 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-3-nitrobenzonitrile |
| SMILES | CN1CCC(CNc2ccc(C#N)cc2[N+](=O)[O-])C1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H18ClFN4O2/c1-24-7-6-14(19(24)13-3-4-15(20)16(21)9-13)11-23-17-5-2-12(10-22)8-18(17)25(26)27/h2-5,8-9,14,19,23H,6-7,11H2,1H3 |
| InChIKey | OUHZXBSVIKTEIU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|