C20H19ClFN5O3 — CID 137272346
7-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137272346) has the molecular formula C20H19ClFN5O3 and a molecular weight of 431.86 g/mol. Its IUPAC name is 7-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137272346 |
| Molecular Formula | C20H19ClFN5O3 |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 7-[[2-(4-chloro-3-fluorophenyl)-1-methylpyrrolidin-3-yl]methylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | CN1CCC(CNc2cc3nc[nH]c(=O)c3cc2[N+](=O)[O-])C1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H19ClFN5O3/c1-26-5-4-12(19(26)11-2-3-14(21)15(22)6-11)9-23-17-8-16-13(7-18(17)27(29)30)20(28)25-10-24-16/h2-3,6-8,10,12,19,23H,4-5,9H2,1H3,(H,24,25,28) |
| InChIKey | BUDIUDLJHFACJP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|