C15H11ClN4O3 — CID 137289174
7-[(4-chlorophenyl)methylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137289174) has the molecular formula C15H11ClN4O3 and a molecular weight of 330.73 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[(4-chlorophenyl)methylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137289174 |
| Molecular Formula | C15H11ClN4O3 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 7-[(4-chlorophenyl)methylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(NCc3ccc(Cl)cc3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H11ClN4O3/c16-10-3-1-9(2-4-10)7-17-13-6-12-11(5-14(13)20(22)23)15(21)19-8-18-12/h1-6,8,17H,7H2,(H,18,19,21) |
| InChIKey | ITACSYIQDSAGQQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|