C17H13F3N4O4 — CID 137316824
6-nitro-7-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]-3H-quinazolin-4-one (PubChem CID 137316824) has the molecular formula C17H13F3N4O4 and a molecular weight of 394.31 g/mol. Its IUPAC name is 6-nitro-7-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]-3H-quinazolin-4-one.
| Compound Name | 6-nitro-7-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137316824 |
| Molecular Formula | C17H13F3N4O4 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 6-nitro-7-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(NCc3ccc(OCC(F)(F)F)cc3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H13F3N4O4/c18-17(19,20)8-28-11-3-1-10(2-4-11)7-21-14-6-13-12(5-15(14)24(26)27)16(25)23-9-22-13/h1-6,9,21H,7-8H2,(H,22,23,25) |
| InChIKey | YSQIZDOPTMJNNY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|