C17H17N5O3 — CID 137289228
7-[[4-(dimethylamino)phenyl]methylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137289228) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 7-[[4-(dimethylamino)phenyl]methylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[[4-(dimethylamino)phenyl]methylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137289228 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 7-[[4-(dimethylamino)phenyl]methylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | CN(C)c1ccc(CNc2cc3nc[nH]c(=O)c3cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N5O3/c1-21(2)12-5-3-11(4-6-12)9-18-15-8-14-13(7-16(15)22(24)25)17(23)20-10-19-14/h3-8,10,18H,9H2,1-2H3,(H,19,20,23) |
| InChIKey | AWSKEMUHYTUGPC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|