C12H14N4O4S — CID 137010029
7-(2-ethylsulfinylethylamino)-6-nitro-3H-quinazolin-4-one (PubChem CID 137010029) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 7-(2-ethylsulfinylethylamino)-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-(2-ethylsulfinylethylamino)-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137010029 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 7-(2-ethylsulfinylethylamino)-6-nitro-3H-quinazolin-4-one |
| SMILES | CCS(=O)CCNc1cc2nc[nH]c(=O)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O4S/c1-2-21(20)4-3-13-10-6-9-8(5-11(10)16(18)19)12(17)15-7-14-9/h5-7,13H,2-4H2,1H3,(H,14,15,17) |
| InChIKey | QRYPKKPUEMBZLD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|