C14H13N5O3S — CID 137275485
7-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137275485) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is 7-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137275485 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 7-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | Cc1cnc(CCNc2cc3nc[nH]c(=O)c3cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H13N5O3S/c1-8-6-16-13(23-8)2-3-15-11-5-10-9(4-12(11)19(21)22)14(20)18-7-17-10/h4-7,15H,2-3H2,1H3,(H,17,18,20) |
| InChIKey | JIBGMPZBCPMSIG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|