C17H22N4O4 — CID 137265030
7-[3-(2-hydroxycyclohexyl)propylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137265030) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 7-[3-(2-hydroxycyclohexyl)propylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[3-(2-hydroxycyclohexyl)propylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137265030 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 7-[3-(2-hydroxycyclohexyl)propylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(NCCCC3CCCCC3O)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H22N4O4/c22-16-6-2-1-4-11(16)5-3-7-18-14-9-13-12(8-15(14)21(24)25)17(23)20-10-19-13/h8-11,16,18,22H,1-7H2,(H,19,20,23) |
| InChIKey | SZDVNVRMSPDSTJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|