C17H15BrN4O3 — CID 137268220
7-[3-(3-bromophenyl)propylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137268220) has the molecular formula C17H15BrN4O3 and a molecular weight of 403.24 g/mol. Its IUPAC name is 7-[3-(3-bromophenyl)propylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[3-(3-bromophenyl)propylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137268220 |
| Molecular Formula | C17H15BrN4O3 |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 7-[3-(3-bromophenyl)propylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(NCCCc3cccc(Br)c3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H15BrN4O3/c18-12-5-1-3-11(7-12)4-2-6-19-15-9-14-13(8-16(15)22(24)25)17(23)21-10-20-14/h1,3,5,7-10,19H,2,4,6H2,(H,20,21,23) |
| InChIKey | QHUAGPMDLGWTGY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|