C11H10F2N4O4 — CID 136785570
7-[(2,2-difluoro-3-hydroxypropyl)amino]-6-nitro-3H-quinazolin-4-one (PubChem CID 136785570) has the molecular formula C11H10F2N4O4 and a molecular weight of 300.22 g/mol. Its IUPAC name is 7-[(2,2-difluoro-3-hydroxypropyl)amino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[(2,2-difluoro-3-hydroxypropyl)amino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136785570 |
| Molecular Formula | C11H10F2N4O4 |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 7-[(2,2-difluoro-3-hydroxypropyl)amino]-6-nitro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(NCC(F)(F)CO)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C11H10F2N4O4/c12-11(13,4-18)3-14-8-2-7-6(1-9(8)17(20)21)10(19)16-5-15-7/h1-2,5,14,18H,3-4H2,(H,15,16,19) |
| InChIKey | NXKXDWMHYDNMGF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|