C17H15FN4O5 — CID 137261840
7-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137261840) has the molecular formula C17H15FN4O5 and a molecular weight of 374.33 g/mol. Its IUPAC name is 7-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137261840 |
| Molecular Formula | C17H15FN4O5 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 7-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-6-nitro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2cc(NCC(O)COc3ccc(F)cc3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H15FN4O5/c18-10-1-3-12(4-2-10)27-8-11(23)7-19-15-6-14-13(5-16(15)22(25)26)17(24)21-9-20-14/h1-6,9,11,19,23H,7-8H2,(H,20,21,24) |
| InChIKey | APURUJCTXVQHLJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|