C14H11Cl2N5O3 — CID 137264934
7-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 137264934) has the molecular formula C14H11Cl2N5O3 and a molecular weight of 368.18 g/mol. Its IUPAC name is 7-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137264934 |
| Molecular Formula | C14H11Cl2N5O3 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 7-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | Cn1c(CNc2cc3nc[nH]c(=O)c3cc2[N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C14H11Cl2N5O3/c1-20-7(2-9(15)13(20)16)5-17-11-4-10-8(3-12(11)21(23)24)14(22)19-6-18-10/h2-4,6,17H,5H2,1H3,(H,18,19,22) |
| InChIKey | OOPCOWBFOUSELS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|