C18H23ClN4O2 — CID 133432547
6-chloro-2-cyclopropyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrimidin-4-amine (PubChem CID 133432547) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133432547 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pyrimidin-4-amine |
| SMILES | Cc1ccc(C(CNc2cc(Cl)nc(C3CC3)n2)N2CCOCC2)o1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-12-2-5-15(25-12)14(23-6-8-24-9-7-23)11-20-17-10-16(19)21-18(22-17)13-3-4-13/h2,5,10,13-14H,3-4,6-9,11H2,1H3,(H,20,21,22) |
| InChIKey | BEUXGQBRNRAXKQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |