C15H19ClN4O3 — CID 94179576
5-chloro-4-[[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-1H-pyridazin-6-one (PubChem CID 94179576) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is 5-chloro-4-[[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 94179576 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 5-chloro-4-[[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-1H-pyridazin-6-one |
| SMILES | Cc1ccc([C@H](CNc2cn[nH]c(=O)c2Cl)N2CCOCC2)o1 |
| InChI | InChI=1S/C15H19ClN4O3/c1-10-2-3-13(23-10)12(20-4-6-22-7-5-20)9-17-11-8-18-19-15(21)14(11)16/h2-3,8,12H,4-7,9H2,1H3,(H2,17,19,21)/t12-/m0/s1 |
| InChIKey | LOPVGVFBLKBQOY-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |