C20H16FN5OS — CID 133434206
2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-3-(5-methyl-2-pyridinyl)quinazolin-4-one (PubChem CID 133434206) has the molecular formula C20H16FN5OS and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-3-(5-methyl-2-pyridinyl)quinazolin-4-one.
| Compound Name | 2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
|---|---|
| PubChem CID | 133434206 |
| Molecular Formula | C20H16FN5OS |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
| SMILES | CCc1ncnc(Sc2nc3ccccc3c(=O)n2-c2ccc(C)cn2)c1F |
| InChI | InChI=1S/C20H16FN5OS/c1-3-14-17(21)18(24-11-23-14)28-20-25-15-7-5-4-6-13(15)19(27)26(20)16-9-8-12(2)10-22-16/h4-11H,3H2,1-2H3 |
| InChIKey | YBKRKUDDMURNDH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |