C17H14BrN3O4 — CID 133435080
N-(4-bromo-3,5-dimethoxyphenyl)-8-nitroisoquinolin-5-amine (PubChem CID 133435080) has the molecular formula C17H14BrN3O4 and a molecular weight of 404.22 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethoxyphenyl)-8-nitroisoquinolin-5-amine.
| Compound Name | N-(4-bromo-3,5-dimethoxyphenyl)-8-nitroisoquinolin-5-amine |
|---|---|
| PubChem CID | 133435080 |
| Molecular Formula | C17H14BrN3O4 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-(4-bromo-3,5-dimethoxyphenyl)-8-nitroisoquinolin-5-amine |
| SMILES | COc1cc(Nc2ccc([N+](=O)[O-])c3cnccc23)cc(OC)c1Br |
| InChI | InChI=1S/C17H14BrN3O4/c1-24-15-7-10(8-16(25-2)17(15)18)20-13-3-4-14(21(22)23)12-9-19-6-5-11(12)13/h3-9,20H,1-2H3 |
| InChIKey | JOYRRLHDBNVQNQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|