C15H13F2N3O3 — CID 133435192
N-[2-(3,4-difluorophenyl)oxolan-3-yl]-3-nitropyridin-2-amine (PubChem CID 133435192) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)oxolan-3-yl]-3-nitropyridin-2-amine.
| Compound Name | N-[2-(3,4-difluorophenyl)oxolan-3-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133435192 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)oxolan-3-yl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NC1CCOC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H13F2N3O3/c16-10-4-3-9(8-11(10)17)14-12(5-7-23-14)19-15-13(20(21)22)2-1-6-18-15/h1-4,6,8,12,14H,5,7H2,(H,18,19) |
| InChIKey | RACFRFFPTNYFCR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|