C17H24N4S — CID 133435785
2-(4-benzyl-3-propylpiperazin-1-yl)-5-methyl-1,3,4-thiadiazole (PubChem CID 133435785) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-(4-benzyl-3-propylpiperazin-1-yl)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(4-benzyl-3-propylpiperazin-1-yl)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 133435785 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-(4-benzyl-3-propylpiperazin-1-yl)-5-methyl-1,3,4-thiadiazole |
| SMILES | CCCC1CN(c2nnc(C)s2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C17H24N4S/c1-3-7-16-13-21(17-19-18-14(2)22-17)11-10-20(16)12-15-8-5-4-6-9-15/h4-6,8-9,16H,3,7,10-13H2,1-2H3 |
| InChIKey | WMFXAUCZQVCNMH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |