C13H20N2O4 — CID 133437767
1-[5-(hydroxymethyl)-2-nitroanilino]-3,3-dimethylbutan-2-ol (PubChem CID 133437767) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)-2-nitroanilino]-3,3-dimethylbutan-2-ol.
| Compound Name | 1-[5-(hydroxymethyl)-2-nitroanilino]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 133437767 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-[5-(hydroxymethyl)-2-nitroanilino]-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)CNc1cc(CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N2O4/c1-13(2,3)12(17)7-14-10-6-9(8-16)4-5-11(10)15(18)19/h4-6,12,14,16-17H,7-8H2,1-3H3 |
| InChIKey | QSDRHVIRMYMTKY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|