C17H26N2O4 — CID 133437876
[3-[(2-tert-butyloxan-3-yl)methylamino]-4-nitrophenyl]methanol (PubChem CID 133437876) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is [3-[(2-tert-butyloxan-3-yl)methylamino]-4-nitrophenyl]methanol.
| Compound Name | [3-[(2-tert-butyloxan-3-yl)methylamino]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 133437876 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [3-[(2-tert-butyloxan-3-yl)methylamino]-4-nitrophenyl]methanol |
| SMILES | CC(C)(C)C1OCCCC1CNc1cc(CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)16-13(5-4-8-23-16)10-18-14-9-12(11-20)6-7-15(14)19(21)22/h6-7,9,13,16,18,20H,4-5,8,10-11H2,1-3H3 |
| InChIKey | RAINEDIBHLXYJY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|