C17H19BrN4O2 — CID 133439643
3-bromo-5-nitro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-2-amine (PubChem CID 133439643) has the molecular formula C17H19BrN4O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is 3-bromo-5-nitro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-2-amine.
| Compound Name | 3-bromo-5-nitro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133439643 |
| Molecular Formula | C17H19BrN4O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 3-bromo-5-nitro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2N2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C17H19BrN4O2/c18-15-10-14(22(23)24)12-20-17(15)19-11-13-6-2-3-7-16(13)21-8-4-1-5-9-21/h2-3,6-7,10,12H,1,4-5,8-9,11H2,(H,19,20) |
| InChIKey | SSRPKILQTIXNBJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|