C18H19BrFN3O — CID 133440647
4-bromo-2-fluoro-6-[4-(3-methylphenyl)piperazin-1-yl]benzamide (PubChem CID 133440647) has the molecular formula C18H19BrFN3O and a molecular weight of 392.27 g/mol. Its IUPAC name is 4-bromo-2-fluoro-6-[4-(3-methylphenyl)piperazin-1-yl]benzamide.
| Compound Name | 4-bromo-2-fluoro-6-[4-(3-methylphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 133440647 |
| Molecular Formula | C18H19BrFN3O |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 4-bromo-2-fluoro-6-[4-(3-methylphenyl)piperazin-1-yl]benzamide |
| SMILES | Cc1cccc(N2CCN(c3cc(Br)cc(F)c3C(N)=O)CC2)c1 |
| InChI | InChI=1S/C18H19BrFN3O/c1-12-3-2-4-14(9-12)22-5-7-23(8-6-22)16-11-13(19)10-15(20)17(16)18(21)24/h2-4,9-11H,5-8H2,1H3,(H2,21,24) |
| InChIKey | RCFWPCSZLWANDN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |