C16H15Cl2N3O3S — CID 133442562
[4-(2,6-dichloro-4-nitrophenyl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone (PubChem CID 133442562) has the molecular formula C16H15Cl2N3O3S and a molecular weight of 400.29 g/mol. Its IUPAC name is [4-(2,6-dichloro-4-nitrophenyl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-(2,6-dichloro-4-nitrophenyl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 133442562 |
| Molecular Formula | C16H15Cl2N3O3S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | [4-(2,6-dichloro-4-nitrophenyl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCCN(c2c(Cl)cc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C16H15Cl2N3O3S/c17-13-8-12(21(23)24)9-14(18)15(13)19-3-1-4-20(6-5-19)16(22)11-2-7-25-10-11/h2,7-10H,1,3-6H2 |
| InChIKey | ANZCWTJHIOYBGC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|