C19H24N4O3 — CID 133442683
N-[3-[[(3-propan-2-yloxypyrazin-2-yl)amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 133442683) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[3-[[(3-propan-2-yloxypyrazin-2-yl)amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[(3-propan-2-yloxypyrazin-2-yl)amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 133442683 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[3-[[(3-propan-2-yloxypyrazin-2-yl)amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | CC(C)Oc1nccnc1NCc1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-13(2)26-19-17(20-8-9-21-19)22-12-14-5-3-6-15(11-14)23-18(24)16-7-4-10-25-16/h3,5-6,8-9,11,13,16H,4,7,10,12H2,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | VLDKDAMCWMJHQM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |