C17H18N2O4 — CID 133443552
N-(3-ethoxy-4-nitrophenyl)-5-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 133443552) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(3-ethoxy-4-nitrophenyl)-5-methyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | N-(3-ethoxy-4-nitrophenyl)-5-methyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 133443552 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(3-ethoxy-4-nitrophenyl)-5-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCOc1cc(NC2COc3ccc(C)cc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O4/c1-3-22-17-9-12(5-6-15(17)19(20)21)18-14-10-23-16-7-4-11(2)8-13(14)16/h4-9,14,18H,3,10H2,1-2H3 |
| InChIKey | BYEMFFZBWKLYTF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|