C17H16F2N4O4 — CID 133444274
4-[1-(2,6-difluoro-4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide (PubChem CID 133444274) has the molecular formula C17H16F2N4O4 and a molecular weight of 378.34 g/mol. Its IUPAC name is 4-[1-(2,6-difluoro-4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-(2,6-difluoro-4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 133444274 |
| Molecular Formula | C17H16F2N4O4 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-[1-(2,6-difluoro-4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OC2CCN(c3c(F)cc([N+](=O)[O-])cc3F)CC2)ccn1 |
| InChI | InChI=1S/C17H16F2N4O4/c18-13-7-10(23(25)26)8-14(19)16(13)22-5-2-11(3-6-22)27-12-1-4-21-15(9-12)17(20)24/h1,4,7-9,11H,2-3,5-6H2,(H2,20,24) |
| InChIKey | KXWNAMWBVORXPQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|