C17H18N4O4 — CID 133444215
4-[1-(4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide (PubChem CID 133444215) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-[1-(4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-(4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 133444215 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-[1-(4-nitrophenyl)piperidin-4-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OC2CCN(c3ccc([N+](=O)[O-])cc3)CC2)ccn1 |
| InChI | InChI=1S/C17H18N4O4/c18-17(22)16-11-15(5-8-19-16)25-14-6-9-20(10-7-14)12-1-3-13(4-2-12)21(23)24/h1-5,8,11,14H,6-7,9-10H2,(H2,18,22) |
| InChIKey | VGJOWIBYOJEUES-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|