C21H20ClN5O3 — CID 133444206
4-[1-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperidin-4-yl]oxypyridine-2-carboxamide (PubChem CID 133444206) has the molecular formula C21H20ClN5O3 and a molecular weight of 425.88 g/mol. Its IUPAC name is 4-[1-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperidin-4-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperidin-4-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 133444206 |
| Molecular Formula | C21H20ClN5O3 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-[1-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperidin-4-yl]oxypyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(OC2CCN(c3cnn(-c4ccccc4)c(=O)c3Cl)CC2)ccn1 |
| InChI | InChI=1S/C21H20ClN5O3/c22-19-18(13-25-27(21(19)29)14-4-2-1-3-5-14)26-10-7-15(8-11-26)30-16-6-9-24-17(12-16)20(23)28/h1-6,9,12-13,15H,7-8,10-11H2,(H2,23,28) |
| InChIKey | ISZONBREZBPFAS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |