C10H16N4O2 — CID 133445878
6-[2-ethoxyethyl(methyl)amino]pyrazine-2-carboxamide (PubChem CID 133445878) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-[2-ethoxyethyl(methyl)amino]pyrazine-2-carboxamide.
| Compound Name | 6-[2-ethoxyethyl(methyl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133445878 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 6-[2-ethoxyethyl(methyl)amino]pyrazine-2-carboxamide |
| SMILES | CCOCCN(C)c1cncc(C(N)=O)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-3-16-5-4-14(2)9-7-12-6-8(13-9)10(11)15/h6-7H,3-5H2,1-2H3,(H2,11,15) |
| InChIKey | XEWGBBYTEFERBA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|