C16H13F6N3O — CID 133446213
3-(trifluoromethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]pyridine (PubChem CID 133446213) has the molecular formula C16H13F6N3O and a molecular weight of 377.29 g/mol. Its IUPAC name is 3-(trifluoromethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]pyridine.
| Compound Name | 3-(trifluoromethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]pyridine |
|---|---|
| PubChem CID | 133446213 |
| Molecular Formula | C16H13F6N3O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-(trifluoromethyl)-2-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]pyridine |
| SMILES | FC(F)(F)c1ccc(OC2CCN(c3ncccc3C(F)(F)F)C2)nc1 |
| InChI | InChI=1S/C16H13F6N3O/c17-15(18,19)10-3-4-13(24-8-10)26-11-5-7-25(9-11)14-12(16(20,21)22)2-1-6-23-14/h1-4,6,8,11H,5,7,9H2 |
| InChIKey | NZJGXFQUGFZTPD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |