C15H13F3N6O — CID 133446315
6-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-7H-purine (PubChem CID 133446315) has the molecular formula C15H13F3N6O and a molecular weight of 350.30 g/mol. Its IUPAC name is 6-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-7H-purine.
| Compound Name | 6-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 133446315 |
| Molecular Formula | C15H13F3N6O |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 6-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]pyrrolidin-1-yl]-7H-purine |
| SMILES | FC(F)(F)c1ccc(OC2CCN(c3ncnc4nc[nH]c34)C2)nc1 |
| InChI | InChI=1S/C15H13F3N6O/c16-15(17,18)9-1-2-11(19-5-9)25-10-3-4-24(6-10)14-12-13(21-7-20-12)22-8-23-14/h1-2,5,7-8,10H,3-4,6H2,(H,20,21,22,23) |
| InChIKey | YEYVNSZARSVHCL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |