C16H18Cl2N4O3S — CID 133447005
3-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1-ethylpyrazin-2-one (PubChem CID 133447005) has the molecular formula C16H18Cl2N4O3S and a molecular weight of 417.32 g/mol. Its IUPAC name is 3-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1-ethylpyrazin-2-one.
| Compound Name | 3-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 133447005 |
| Molecular Formula | C16H18Cl2N4O3S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 3-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(N2CCN(S(=O)(=O)c3cccc(Cl)c3Cl)CC2)c1=O |
| InChI | InChI=1S/C16H18Cl2N4O3S/c1-2-20-7-6-19-15(16(20)23)21-8-10-22(11-9-21)26(24,25)13-5-3-4-12(17)14(13)18/h3-7H,2,8-11H2,1H3 |
| InChIKey | BFZFDTAVNKUNMC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |