C16H16N6O — CID 133449091
6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridazine-3-carboxamide (PubChem CID 133449091) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridazine-3-carboxamide.
| Compound Name | 6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133449091 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridazine-3-carboxamide |
| SMILES | Cn1cc(CNc2ccc(C(N)=O)nn2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H16N6O/c1-22-10-12(15(21-22)11-5-3-2-4-6-11)9-18-14-8-7-13(16(17)23)19-20-14/h2-8,10H,9H2,1H3,(H2,17,23)(H,18,20) |
| InChIKey | CWWXKCPMWXJMSL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |