C17H16ClN5O — CID 133449160
5-chloro-6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridine-3-carboxamide (PubChem CID 133449160) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is 5-chloro-6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133449160 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 5-chloro-6-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]pyridine-3-carboxamide |
| SMILES | Cn1cc(CNc2ncc(C(N)=O)cc2Cl)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H16ClN5O/c1-23-10-13(15(22-23)11-5-3-2-4-6-11)9-21-17-14(18)7-12(8-20-17)16(19)24/h2-8,10H,9H2,1H3,(H2,19,24)(H,20,21) |
| InChIKey | UXGYQEVGCSBJQC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |