C14H16F3N5O — CID 133450992
4-methoxy-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidine (PubChem CID 133450992) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is 4-methoxy-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidine.
| Compound Name | 4-methoxy-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133450992 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-methoxy-2-[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]pyrimidine |
| SMILES | COc1ccnc(N2CCCC(n3ccc(C(F)(F)F)n3)C2)n1 |
| InChI | InChI=1S/C14H16F3N5O/c1-23-12-4-6-18-13(19-12)21-7-2-3-10(9-21)22-8-5-11(20-22)14(15,16)17/h4-6,8,10H,2-3,7,9H2,1H3 |
| InChIKey | UNDFGUOTVKDPOI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |