C19H18BrN3O3S — CID 133451292
2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-5-bromobenzonitrile (PubChem CID 133451292) has the molecular formula C19H18BrN3O3S and a molecular weight of 448.34 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-5-bromobenzonitrile.
| Compound Name | 2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-5-bromobenzonitrile |
|---|---|
| PubChem CID | 133451292 |
| Molecular Formula | C19H18BrN3O3S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-5-bromobenzonitrile |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(c3ccc(Br)cc3C#N)CC2)cc1 |
| InChI | InChI=1S/C19H18BrN3O3S/c1-14(24)15-2-5-18(6-3-15)27(25,26)23-10-8-22(9-11-23)19-7-4-17(20)12-16(19)13-21/h2-7,12H,8-11H2,1H3 |
| InChIKey | MPNXTGISZYQDHU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |