C19H19F3N2O5S2 — CID 55636005
1-[4-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]sulfonylphenyl]ethanone (PubChem CID 55636005) has the molecular formula C19H19F3N2O5S2 and a molecular weight of 476.50 g/mol. Its IUPAC name is 1-[4-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 55636005 |
| Molecular Formula | C19H19F3N2O5S2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 1-[4-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(c3ccccc3S(=O)(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H19F3N2O5S2/c1-14(25)15-6-8-16(9-7-15)31(28,29)24-12-10-23(11-13-24)17-4-2-3-5-18(17)30(26,27)19(20,21)22/h2-9H,10-13H2,1H3 |
| InChIKey | JRDXNCZKBQKVFC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |