C17H20F3N3O5S — CID 55635933
1-morpholin-4-yl-2-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 55635933) has the molecular formula C17H20F3N3O5S and a molecular weight of 435.42 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-morpholin-4-yl-2-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 55635933 |
| Molecular Formula | C17H20F3N3O5S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-morpholin-4-yl-2-[4-[2-(trifluoromethylsulfonyl)phenyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(c2ccccc2S(=O)(=O)C(F)(F)F)CC1)N1CCOCC1 |
| InChI | InChI=1S/C17H20F3N3O5S/c18-17(19,20)29(26,27)14-4-2-1-3-13(14)21-5-7-22(8-6-21)15(24)16(25)23-9-11-28-12-10-23/h1-4H,5-12H2 |
| InChIKey | XJQVNVIDEASOAI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|