C21H22N3O3S+ — CID 9196056
1-[4-(4-quinolin-1-ium-2-ylpiperazin-1-yl)sulfonylphenyl]ethanone (PubChem CID 9196056) has the molecular formula C21H22N3O3S+ and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[4-(4-quinolin-1-ium-2-ylpiperazin-1-yl)sulfonylphenyl]ethanone.
| Compound Name | 1-[4-(4-quinolin-1-ium-2-ylpiperazin-1-yl)sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 9196056 |
| Molecular Formula | C21H22N3O3S+ |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[4-(4-quinolin-1-ium-2-ylpiperazin-1-yl)sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(c3ccc4ccccc4[nH+]3)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-16(25)17-6-9-19(10-7-17)28(26,27)24-14-12-23(13-15-24)21-11-8-18-4-2-3-5-20(18)22-21/h2-11H,12-15H2,1H3/p+1 |
| InChIKey | MHCJEKSWHROIPY-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 71.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |