C24H23N3O4S — CID 2440581
(E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-quinolin-2-ylprop-2-en-1-one (PubChem CID 2440581) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is (E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-quinolin-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-quinolin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 2440581 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-quinolin-2-ylprop-2-en-1-one |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)/C=C/c3ccc4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-18(28)19-7-11-22(12-8-19)32(30,31)27-16-14-26(15-17-27)24(29)13-10-21-9-6-20-4-2-3-5-23(20)25-21/h2-13H,14-17H2,1H3/b13-10+ |
| InChIKey | QZOSMYUESUBGRT-JLHYYAGUSA-N |
| XLogP | 2.98 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|