C25H23FN2O4S2 — CID 36706693
(E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-en-1-one (PubChem CID 36706693) has the molecular formula C25H23FN2O4S2 and a molecular weight of 498.60 g/mol. Its IUPAC name is (E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 36706693 |
| Molecular Formula | C25H23FN2O4S2 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | (E)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-3-[5-(2-fluorophenyl)thiophen-2-yl]prop-2-en-1-one |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)/C=C/c3ccc(-c4ccccc4F)s3)CC2)cc1 |
| InChI | InChI=1S/C25H23FN2O4S2/c1-18(29)19-6-10-21(11-7-19)34(31,32)28-16-14-27(15-17-28)25(30)13-9-20-8-12-24(33-20)22-4-2-3-5-23(22)26/h2-13H,14-17H2,1H3/b13-9+ |
| InChIKey | WIXRJTFQUNIDHX-UKTHLTGXSA-N |
| XLogP | 4.30 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|