C17H16Cl2N2O3S2 — CID 24608160
(E)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-chlorothiophen-2-yl)prop-2-en-1-one (PubChem CID 24608160) has the molecular formula C17H16Cl2N2O3S2 and a molecular weight of 431.37 g/mol. Its IUPAC name is (E)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-chlorothiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-chlorothiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24608160 |
| Molecular Formula | C17H16Cl2N2O3S2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | (E)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-chlorothiophen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)s1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H16Cl2N2O3S2/c18-13-1-5-15(6-2-13)26(23,24)21-11-9-20(10-12-21)17(22)8-4-14-3-7-16(19)25-14/h1-8H,9-12H2/b8-4+ |
| InChIKey | GWUSNEROSQTICT-XBXARRHUSA-N |
| XLogP | 3.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|