C22H26N3O2S+ — CID 9108517
2-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium (PubChem CID 9108517) has the molecular formula C22H26N3O2S+ and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium.
| Compound Name | 2-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium |
|---|---|
| PubChem CID | 9108517 |
| Molecular Formula | C22H26N3O2S+ |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(c3ccc4ccccc4[nH+]3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-2-5-18-8-11-20(12-9-18)28(26,27)25-16-14-24(15-17-25)22-13-10-19-6-3-4-7-21(19)23-22/h3-4,6-13H,2,5,14-17H2,1H3/p+1 |
| InChIKey | KZDIZYFLOWHZOL-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |