C21H27Cl2N3O2S — CID 69051868
5-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]-1H-indole;dihydrochloride (PubChem CID 69051868) has the molecular formula C21H27Cl2N3O2S and a molecular weight of 456.44 g/mol. Its IUPAC name is 5-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]-1H-indole;dihydrochloride.
| Compound Name | 5-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]-1H-indole;dihydrochloride |
|---|---|
| PubChem CID | 69051868 |
| Molecular Formula | C21H27Cl2N3O2S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]-1H-indole;dihydrochloride |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(c3ccc4[nH]ccc4c3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H25N3O2S.2ClH/c1-2-3-17-4-7-20(8-5-17)27(25,26)24-14-12-23(13-15-24)19-6-9-21-18(16-19)10-11-22-21;;/h4-11,16,22H,2-3,12-15H2,1H3;2*1H |
| InChIKey | CTSGXHWHJMDFDT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |