C22H24N3O2S+ — CID 9172486
2-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]quinolin-1-ium (PubChem CID 9172486) has the molecular formula C22H24N3O2S+ and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]quinolin-1-ium.
| Compound Name | 2-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]quinolin-1-ium |
|---|---|
| PubChem CID | 9172486 |
| Molecular Formula | C22H24N3O2S+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]quinolin-1-ium |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1CCN(c2ccc3ccccc3[nH+]2)CC1 |
| InChI | InChI=1S/C22H23N3O2S/c26-28(27,20-10-8-17-5-3-6-19(17)16-20)25-14-12-24(13-15-25)22-11-9-18-4-1-2-7-21(18)23-22/h1-2,4,7-11,16H,3,5-6,12-15H2/p+1 |
| InChIKey | XCXZTPSCFZUHDT-UHFFFAOYSA-O |
| XLogP | 2.65 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |