C22H26N3O2S+ — CID 9111553
2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium (PubChem CID 9111553) has the molecular formula C22H26N3O2S+ and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium.
| Compound Name | 2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium |
|---|---|
| PubChem CID | 9111553 |
| Molecular Formula | C22H26N3O2S+ |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]quinolin-1-ium |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(c3ccc4ccccc4[nH+]3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H25N3O2S/c1-16-14-17(2)22(18(3)15-16)28(26,27)25-12-10-24(11-13-25)21-9-8-19-6-4-5-7-20(19)23-21/h4-9,14-15H,10-13H2,1-3H3/p+1 |
| InChIKey | YFSPZOMVBZJMDR-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |