C21H21FN4O3 — CID 133452609
5-(2-fluoro-5-methoxy-4-nitrophenyl)-1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine (PubChem CID 133452609) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 5-(2-fluoro-5-methoxy-4-nitrophenyl)-1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine.
| Compound Name | 5-(2-fluoro-5-methoxy-4-nitrophenyl)-1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 133452609 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 5-(2-fluoro-5-methoxy-4-nitrophenyl)-1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
| SMILES | COc1cc(N2CCc3c(ncn3CCc3ccccc3)C2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21FN4O3/c1-29-21-12-19(16(22)11-20(21)26(27)28)24-10-8-18-17(13-24)23-14-25(18)9-7-15-5-3-2-4-6-15/h2-6,11-12,14H,7-10,13H2,1H3 |
| InChIKey | CROOCAYDAWTWLW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|