C16H23N3O4 — CID 133453194
3-methyl-5-nitro-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]pyridine (PubChem CID 133453194) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-methyl-5-nitro-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]pyridine.
| Compound Name | 3-methyl-5-nitro-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 133453194 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-methyl-5-nitro-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]pyridine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1N1CCC(OCC2CCOC2)CC1 |
| InChI | InChI=1S/C16H23N3O4/c1-12-8-14(19(20)21)9-17-16(12)18-5-2-15(3-6-18)23-11-13-4-7-22-10-13/h8-9,13,15H,2-7,10-11H2,1H3 |
| InChIKey | JPSSFYRJDOCDMT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|